DC Field | Value | Language |
---|---|---|
dc.contributor.author | Ahn, SongIh | ko |
dc.contributor.author | Song, SH | ko |
dc.contributor.author | Park, EY | ko |
dc.contributor.author | Son, MJ | ko |
dc.contributor.author | Ko, UH | ko |
dc.contributor.author | Park, JS | ko |
dc.contributor.author | Shin, Jennifer Hyunjong | ko |
dc.date.accessioned | 2014-12-08T08:31:40Z | - |
dc.date.available | 2014-12-08T08:31:40Z | - |
dc.date.created | 2014-10-06 | - |
dc.date.issued | 2014-09-29 | - |
dc.identifier.citation | Biofabrication2014(ICB2014) | - |
dc.identifier.uri | http://hdl.handle.net/10203/191601 | - |
dc.language | English | - |
dc.publisher | International society for biofabrication | - |
dc.title | Effects of physico-chemical stimulus on the migrating behavior of brain immune cells | - |
dc.type | Conference | - |
dc.type.rims | CONF | - |
dc.citation.publicationname | Biofabrication2014(ICB2014) | - |
dc.identifier.conferencecountry | KO | - |
dc.identifier.conferencelocation | POSCO International Center, POSTECH | - |
dc.contributor.localauthor | Shin, Jennifer Hyunjong | - |
dc.contributor.nonIdAuthor | Ahn, SongIh | - |
dc.contributor.nonIdAuthor | Song, SH | - |
dc.contributor.nonIdAuthor | Park, EY | - |
dc.contributor.nonIdAuthor | Son, MJ | - |
dc.contributor.nonIdAuthor | Ko, UH | - |
dc.contributor.nonIdAuthor | Park, JS | - |
Items in DSpace are protected by copyright, with all rights reserved, unless otherwise indicated.